CAS 72207-94-4 appears in our catalog under these names: 2-ethoxy-4-formylphenyl acetate, 98%, 2-Ethoxy-4-formylphenyl Acetate, >98.0%(GC), 2-Ethoxy-4-formylphenyl acetate, 97%, 97%, Ethylvanillin acetate/ 99.73% (existing batch purity), Ethylvanillin acetate 97%. Offered by: Fluorochem, TCI, Chemat, TargetMol, Ambeed. Available pack sizes: 100mg, 250mg, 25g, 100g, 5g, 1mg, 1g, 500mg.
(2-ethoxy-4-formylphenyl) acetate (CAS 72207-94-4) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: (2-ethoxy-4-formylphenyl) acetate. InChIKey: XRZFVPCFHPIMAD-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | (2-ethoxy-4-formylphenyl) acetate |
| InChIKey | XRZFVPCFHPIMAD-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)C=O)OC(=O)C |
Computed by PubChem (NCBI)