CAS 722444-62-4 is the registry number for 1-(5-Amino-2,3-dihydro-1H-isoindol-2-yl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 100mg, 250mg, 500mg, 2000mg, 1000mg.
1-(5-amino-1,3-dihydroisoindol-2-yl)ethanone (CAS 722444-62-4) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: 1-(5-amino-1,3-dihydroisoindol-2-yl)ethanone. InChIKey: YIOYWZUOBVMFGA-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 1-(5-amino-1,3-dihydroisoindol-2-yl)ethanone |
| InChIKey | YIOYWZUOBVMFGA-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CC2=C(C1)C=C(C=C2)N |
Computed by PubChem (NCBI)