Products 72289-51-1
CAS 72289-51-1 is the registry number for Z-Thr-OtBu, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2S,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate (CAS 72289-51-1) is a chemical compound with the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. IUPAC name: tert-butyl (2S,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate. InChIKey: ZRQUTSHDNGTITM-YPMHNXCESA-N.
| Molecular formula | C16H23NO5 |
|---|---|
| Molecular weight | 309.36 g/mol |
| IUPAC name | tert-butyl (2S,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate |
| InChIKey | ZRQUTSHDNGTITM-YPMHNXCESA-N |
| SMILES | C[C@H]([C@@H](C(=O)OC(C)(C)C)NC(=O)OCC1=CC=CC=C1)O |
Computed by PubChem (NCBI)