CAS 72378-50-8 is the registry number for Bivalirudin Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3S)-3-amino-2,5-dioxopyrrolidin-1-yl]acetic acid (CAS 72378-50-8) is a chemical compound with the molecular formula C6H8N2O4 and a molecular weight of 172.14 g/mol. IUPAC name: 2-[(3S)-3-amino-2,5-dioxopyrrolidin-1-yl]acetic acid. InChIKey: DXYLVSIXCGPUHP-VKHMYHEASA-N.
| Molecular formula | C6H8N2O4 |
|---|---|
| Molecular weight | 172.14 g/mol |
| IUPAC name | 2-[(3S)-3-amino-2,5-dioxopyrrolidin-1-yl]acetic acid |
| InChIKey | DXYLVSIXCGPUHP-VKHMYHEASA-N |
| SMILES | C1[C@@H](C(=O)N(C1=O)CC(=O)O)N |
Computed by PubChem (NCBI)