Products 72378-50-8

CAS 72378-50-8 is the registry number for Bivalirudin Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(3S)-3-amino-2,5-dioxopyrrolidin-1-yl]acetic acid (CAS 72378-50-8) is a chemical compound with the molecular formula C6H8N2O4 and a molecular weight of 172.14 g/mol. IUPAC name: 2-[(3S)-3-amino-2,5-dioxopyrrolidin-1-yl]acetic acid. InChIKey: DXYLVSIXCGPUHP-VKHMYHEASA-N.

Identity
Molecular formulaC6H8N2O4
Molecular weight172.14 g/mol
IUPAC name2-[(3S)-3-amino-2,5-dioxopyrrolidin-1-yl]acetic acid
InChIKeyDXYLVSIXCGPUHP-VKHMYHEASA-N
SMILESC1[C@@H](C(=O)N(C1=O)CC(=O)O)N

Computed by PubChem (NCBI)