CAS 72482-14-5 appears in our catalog under these names: 3-Chloro-2,4-dimethoxybenzaldehyde, 95%, 3–Chloro–2,4–dimethoxybenzaldehyde, 3-chloro-2,4-dimethoxybenzaldehyde, 3-Chloro-2,4-dimethoxybenzaldehyde, 98%, 98%, 3-Chloro-2,4-dimethoxybenzaldehyde, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 2,5g.
3-chloro-2,4-dimethoxybenzaldehyde (CAS 72482-14-5) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: 3-chloro-2,4-dimethoxybenzaldehyde. InChIKey: XBWCSKPPTSIOOA-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 3-chloro-2,4-dimethoxybenzaldehyde |
| InChIKey | XBWCSKPPTSIOOA-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C=O)OC)Cl |
Computed by PubChem (NCBI)