CAS 72583-89-2 is the registry number for Benzofuran-2-carboximidhydrazide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N'-amino-1-benzofuran-2-carboximidamide (CAS 72583-89-2) is a chemical compound with the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. IUPAC name: N'-amino-1-benzofuran-2-carboximidamide. InChIKey: WQEOABQHDNEOOV-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | N'-amino-1-benzofuran-2-carboximidamide |
| InChIKey | WQEOABQHDNEOOV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)/C(=N/N)/N |
Computed by PubChem (NCBI)