CAS 726152-04-1 is the registry number for 2-(2-Chloro-acetylamino)-5-isopropyl-thiophene-3-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Ethyl 2-[(2-chloroacetyl)amino]-5-propan-2-ylthiophene-3-carboxylate (CAS 726152-04-1) is a chemical compound with the molecular formula C12H16ClNO3S and a molecular weight of 289.78 g/mol. IUPAC name: ethyl 2-[(2-chloroacetyl)amino]-5-propan-2-ylthiophene-3-carboxylate. InChIKey: JYUINWWMPWHPAB-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO3S |
|---|---|
| Molecular weight | 289.78 g/mol |
| IUPAC name | ethyl 2-[(2-chloroacetyl)amino]-5-propan-2-ylthiophene-3-carboxylate |
| InChIKey | JYUINWWMPWHPAB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC(=C1)C(C)C)NC(=O)CCl |
Computed by PubChem (NCBI)