CAS 851710-39-9 is the registry number for N-(2-Chloro-5-(methylsulfonyl)phenyl)pivalamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2-chloro-5-methylsulfonylphenyl)-2,2-dimethylpropanamide (CAS 851710-39-9) is a chemical compound with the molecular formula C12H16ClNO3S and a molecular weight of 289.78 g/mol. IUPAC name: N-(2-chloro-5-methylsulfonylphenyl)-2,2-dimethylpropanamide. InChIKey: SKUIYTTXEWLYHQ-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO3S |
|---|---|
| Molecular weight | 289.78 g/mol |
| IUPAC name | N-(2-chloro-5-methylsulfonylphenyl)-2,2-dimethylpropanamide |
| InChIKey | SKUIYTTXEWLYHQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(C=CC(=C1)S(=O)(=O)C)Cl |
Computed by PubChem (NCBI)