CAS 870529-81-0 appears in our catalog under these names: (1-[(4-Chlorophenyl)sulfonyl]-4-piperidinyl)methanol, 95%, (1-((4-Chlorophenyl)sulfonyl)piperidin-4-yl)methanol, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]methanol (CAS 870529-81-0) is a chemical compound with the molecular formula C12H16ClNO3S and a molecular weight of 289.78 g/mol. IUPAC name: [1-(4-chlorophenyl)sulfonylpiperidin-4-yl]methanol. InChIKey: QHHQGEILPOECEJ-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO3S |
|---|---|
| Molecular weight | 289.78 g/mol |
| IUPAC name | [1-(4-chlorophenyl)sulfonylpiperidin-4-yl]methanol |
| InChIKey | QHHQGEILPOECEJ-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1CO)S(=O)(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)