CAS 782462-71-9 is the registry number for 2-Chloro-1-(1-(1,1-dioxidotetrahydrothien-3-yl)-2,5-dimethyl-1H-pyrrol-3-yl)ethanone. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-chloro-1-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]ethanone (CAS 782462-71-9) is a chemical compound with the molecular formula C12H16ClNO3S and a molecular weight of 289.78 g/mol. IUPAC name: 2-chloro-1-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]ethanone. InChIKey: ASJUFHKRTIOKKA-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO3S |
|---|---|
| Molecular weight | 289.78 g/mol |
| IUPAC name | 2-chloro-1-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]ethanone |
| InChIKey | ASJUFHKRTIOKKA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2CCS(=O)(=O)C2)C)C(=O)CCl |
Computed by PubChem (NCBI)