CAS 736960-62-6 appears in our catalog under these names: 2-(2-Chloro-acetylamino)-5-ethyl-4-methyl-thiophene-3-carboxylic acid ethyl ester, 95%, Ethyl 2-(2-chloroacetamido)-5-ethyl-4-methylthiophene-3-carboxylate, 95%, Ethyl 2-(2-chloroacetamido)-5-ethyl-4-methylthiophene-3-carboxylate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
Ethyl 2-[(2-chloroacetyl)amino]-5-ethyl-4-methylthiophene-3-carboxylate (CAS 736960-62-6) is a chemical compound with the molecular formula C12H16ClNO3S and a molecular weight of 289.78 g/mol. IUPAC name: ethyl 2-[(2-chloroacetyl)amino]-5-ethyl-4-methylthiophene-3-carboxylate. InChIKey: HBIMWUDFMNKFKL-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO3S |
|---|---|
| Molecular weight | 289.78 g/mol |
| IUPAC name | ethyl 2-[(2-chloroacetyl)amino]-5-ethyl-4-methylthiophene-3-carboxylate |
| InChIKey | HBIMWUDFMNKFKL-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=C(S1)NC(=O)CCl)C(=O)OCC)C |
Computed by PubChem (NCBI)