CAS 727-71-9 appears in our catalog under these names: 2',4',6'–Trihydroxy–2–phenylacetophenone, 2',4',6'-Trihydroxy-2-phenylacetophenone, >96.0%(GC). Offered by: GLPBio, TCI. Available pack sizes: 1g, 200mg, 5g.
2-phenyl-1-(2,4,6-trihydroxyphenyl)ethanone (CAS 727-71-9) is a chemical compound with the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. IUPAC name: 2-phenyl-1-(2,4,6-trihydroxyphenyl)ethanone. InChIKey: SLHBRIIHMDJIBT-UHFFFAOYSA-N.
| Molecular formula | C14H12O4 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | 2-phenyl-1-(2,4,6-trihydroxyphenyl)ethanone |
| InChIKey | SLHBRIIHMDJIBT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)C2=C(C=C(C=C2O)O)O |
Computed by PubChem (NCBI)