CAS 727652-33-7 is the registry number for 3-(2-(3-Methoxyphenyl)-8-methylimidazo(1,2-a)pyridin-3-yl)acrylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
(E)-3-[2-(3-methoxyphenyl)-8-methylimidazo[1,2-a]pyridin-3-yl]prop-2-enoic acid (CAS 727652-33-7) is a chemical compound with the molecular formula C18H16N2O3 and a molecular weight of 308.3 g/mol. IUPAC name: (E)-3-[2-(3-methoxyphenyl)-8-methylimidazo[1,2-a]pyridin-3-yl]prop-2-enoic acid. InChIKey: VBXMICYZEKURII-CMDGGOBGSA-N.
| Molecular formula | C18H16N2O3 |
|---|---|
| Molecular weight | 308.3 g/mol |
| IUPAC name | (E)-3-[2-(3-methoxyphenyl)-8-methylimidazo[1,2-a]pyridin-3-yl]prop-2-enoic acid |
| InChIKey | VBXMICYZEKURII-CMDGGOBGSA-N |
| SMILES | CC1=CC=CN2C1=NC(=C2/C=C/C(=O)O)C3=CC(=CC=C3)OC |
Computed by PubChem (NCBI)