CAS 728918-98-7 appears in our catalog under these names: Biphenyl-4,4'-dicarboxylic acid 4-isopropyl ester, 95+%, Biphenyl-4,4'-dicarboxylic acid 4-isopropyl ester, 98%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g.
4-(4-propan-2-yloxycarbonylphenyl)benzoic acid (CAS 728918-98-7) is a chemical compound with the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. IUPAC name: 4-(4-propan-2-yloxycarbonylphenyl)benzoic acid. InChIKey: FVYNVKAYQZUHIY-UHFFFAOYSA-N.
| Molecular formula | C17H16O4 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | 4-(4-propan-2-yloxycarbonylphenyl)benzoic acid |
| InChIKey | FVYNVKAYQZUHIY-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)