CAS 728919-21-9 appears in our catalog under these names: 3',4'-Dimethylbiphenyl-3-carboxylic acid, 95%, 3′,4′–Dimethyl–biphenyl–3–carboxylic acid, 3',4'-Dimethylbiphenyl-3-carboxylic acid, ≥97%, ≥97%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 50mg.
3-(3,4-dimethylphenyl)benzoic acid (CAS 728919-21-9) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: 3-(3,4-dimethylphenyl)benzoic acid. InChIKey: QCNROSMDZFNPPB-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 3-(3,4-dimethylphenyl)benzoic acid |
| InChIKey | QCNROSMDZFNPPB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CC(=CC=C2)C(=O)O)C |
Computed by PubChem (NCBI)