CAS 728919-63-9 appears in our catalog under these names: 2-(m-tolyl)ethanesulfonyl chloride, 95+%, 2-m-Tolyl-ethanesulfonyl chloride. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 50mg, 100mg, 250mg, 500mg.
2-(3-methylphenyl)ethanesulfonyl chloride (CAS 728919-63-9) is a chemical compound with the molecular formula C9H11ClO2S and a molecular weight of 218.70 g/mol. IUPAC name: 2-(3-methylphenyl)ethanesulfonyl chloride. InChIKey: XZSJPDHSGCVMSM-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO2S |
|---|---|
| Molecular weight | 218.70 g/mol |
| IUPAC name | 2-(3-methylphenyl)ethanesulfonyl chloride |
| InChIKey | XZSJPDHSGCVMSM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)CCS(=O)(=O)Cl |
Computed by PubChem (NCBI)