CAS 7291-96-5 is the registry number for 2-((4-Nitrophenyl)methyl)-1H-1,3-benzodiazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[(4-nitrophenyl)methyl]-1H-benzimidazole (CAS 7291-96-5) is a chemical compound with the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. IUPAC name: 2-[(4-nitrophenyl)methyl]-1H-benzimidazole. InChIKey: GDPNXLZOMJULAA-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O2 |
|---|---|
| Molecular weight | 253.26 g/mol |
| IUPAC name | 2-[(4-nitrophenyl)methyl]-1H-benzimidazole |
| InChIKey | GDPNXLZOMJULAA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)CC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)