Products 7315-96-0
CAS 7315-96-0 appears in our catalog under these names: 1,5–Naphthalenedicarboxylic acid, Naphthalene-1,5-dicarboxylic acid, 95%, 95%, 1,5-Naphthalenedicarboxylic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 50mg, 500mg.
Naphthalene-1,5-dicarboxylic acid (CAS 7315-96-0) is a chemical compound with the molecular formula C12H8O4 and a molecular weight of 216.19 g/mol. IUPAC name: naphthalene-1,5-dicarboxylic acid. InChIKey: DFFZOPXDTCDZDP-UHFFFAOYSA-N.
| Molecular formula | C12H8O4 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | naphthalene-1,5-dicarboxylic acid |
| InChIKey | DFFZOPXDTCDZDP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC=C2C(=O)O)C(=C1)C(=O)O |
Computed by PubChem (NCBI)