Products 73215-91-5
CAS 73215-91-5 is the registry number for Chloranthalactone C. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(1S,9S,10R,12S,13R)-4,9-dimethyl-5-oxo-6-oxatetracyclo[7.4.0.03,7.010,12]trideca-3,7-dien-13-yl]methyl acetate (CAS 73215-91-5) is a chemical compound with the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. IUPAC name: [(1S,9S,10R,12S,13R)-4,9-dimethyl-5-oxo-6-oxatetracyclo[7.4.0.03,7.010,12]trideca-3,7-dien-13-yl]methyl acetate. InChIKey: AFQYMJMJVURITP-MAKQCAJESA-N.
| Molecular formula | C17H20O4 |
|---|---|
| Molecular weight | 288.34 g/mol |
| IUPAC name | [(1S,9S,10R,12S,13R)-4,9-dimethyl-5-oxo-6-oxatetracyclo[7.4.0.03,7.010,12]trideca-3,7-dien-13-yl]methyl acetate |
| InChIKey | AFQYMJMJVURITP-MAKQCAJESA-N |
| SMILES | CC1=C2C[C@H]3[C@@H]([C@H]4C[C@H]4[C@@]3(C=C2OC1=O)C)COC(=O)C |
Computed by PubChem (NCBI)
Synonyms:
Chloranthalactone C, orb2946001