Products 732249-89-7
CAS 732249-89-7 appears in our catalog under these names: ethyl 2-(3-cyanophenyl)-2-oxoacetate, ≥98.9%, ≥98.9%, Ethyl 3-cyanobenzoylformate, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
Ethyl 2-(3-cyanophenyl)-2-oxoacetate (CAS 732249-89-7) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: ethyl 2-(3-cyanophenyl)-2-oxoacetate. InChIKey: GECHQYJYTIZQSB-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | ethyl 2-(3-cyanophenyl)-2-oxoacetate |
| InChIKey | GECHQYJYTIZQSB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=CC=CC(=C1)C#N |
Computed by PubChem (NCBI)