CAS 732308-82-6 appears in our catalog under these names: 2-(4-(tert-Butoxycarbonyl)phenyl)acetic acid, 98%, 2-(4-(tert-Butoxycarbonyl)phenyl)acetic acid, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 50mg, 100mg, 250mg, 1g.
2-[4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]acetic acid (CAS 732308-82-6) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: 2-[4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]acetic acid. InChIKey: ANYWJCSOPVLRHC-UHFFFAOYSA-N.
| Molecular formula | C13H16O4 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | 2-[4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]acetic acid |
| InChIKey | ANYWJCSOPVLRHC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=C(C=C1)CC(=O)O |
Computed by PubChem (NCBI)