CAS 73262-04-1 is the registry number for 2-Amino-6-bromo-3-formylchromone, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 100mg.
2-amino-6-bromo-4-oxochromene-3-carbaldehyde (CAS 73262-04-1) is a chemical compound with the molecular formula C10H6BrNO3 and a molecular weight of 268.06 g/mol. IUPAC name: 2-amino-6-bromo-4-oxochromene-3-carbaldehyde. InChIKey: AUIUQJYBTPKQGS-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNO3 |
|---|---|
| Molecular weight | 268.06 g/mol |
| IUPAC name | 2-amino-6-bromo-4-oxochromene-3-carbaldehyde |
| InChIKey | AUIUQJYBTPKQGS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=O)C(=C(O2)N)C=O |
Computed by PubChem (NCBI)