Products 73340-48-4
CAS 73340-48-4 is the registry number for Vismiaquinone. Offered by: Biosynth. Available pack sizes: 1mg.
1,8-dihydroxy-3-methoxy-6-methyl-2-[(E)-3-methylbut-1-enyl]anthracene-9,10-dione (CAS 73340-48-4) is a chemical compound with the molecular formula C21H20O5 and a molecular weight of 352.4 g/mol. IUPAC name: 1,8-dihydroxy-3-methoxy-6-methyl-2-[(E)-3-methylbut-1-enyl]anthracene-9,10-dione. InChIKey: FMUNWYQUOSZHBF-AATRIKPKSA-N.
| Molecular formula | C21H20O5 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | 1,8-dihydroxy-3-methoxy-6-methyl-2-[(E)-3-methylbut-1-enyl]anthracene-9,10-dione |
| InChIKey | FMUNWYQUOSZHBF-AATRIKPKSA-N |
| SMILES | CC1=CC2=C(C(=C1)O)C(=O)C3=C(C(=C(C=C3C2=O)OC)/C=C/C(C)C)O |
Computed by PubChem (NCBI)