CAS 73437-28-2 appears in our catalog under these names: (1,2-Benzothiazol-3-yl)methanamine hydrochloride, 95%, (1,2-Benzothiazol-3-yl)methanamine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1,2-benzothiazol-3-ylmethanamine;hydrochloride (CAS 73437-28-2) is a chemical compound with the molecular formula C8H9ClN2S and a molecular weight of 200.69 g/mol. IUPAC name: 1,2-benzothiazol-3-ylmethanamine;hydrochloride. InChIKey: YFBDODSMXGYBQN-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2S |
|---|---|
| Molecular weight | 200.69 g/mol |
| IUPAC name | 1,2-benzothiazol-3-ylmethanamine;hydrochloride |
| InChIKey | YFBDODSMXGYBQN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NS2)CN.Cl |
Computed by PubChem (NCBI)