CAS 73437-35-1 is the registry number for (5-Chloro-1,2-benzothiazol-3-yl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(5-chloro-1,2-benzothiazol-3-yl)methanamine;hydrochloride (CAS 73437-35-1) is a chemical compound with the molecular formula C8H8Cl2N2S and a molecular weight of 235.13 g/mol. IUPAC name: (5-chloro-1,2-benzothiazol-3-yl)methanamine;hydrochloride. InChIKey: WUHBHUBUCDNEEP-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2S |
|---|---|
| Molecular weight | 235.13 g/mol |
| IUPAC name | (5-chloro-1,2-benzothiazol-3-yl)methanamine;hydrochloride |
| InChIKey | WUHBHUBUCDNEEP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=NS2)CN.Cl |
Computed by PubChem (NCBI)