Products 73483-88-2
CAS 73483-88-2 is the registry number for Tetrachyrin. Offered by: Biosynth, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 50mg, 25mg, Get quote.
(1S,2S,5R,8S,11R,12R)-2,12-dimethyl-6-methylidene-16-oxapentacyclo[10.3.2.15,8.01,11.02,8]octadecan-17-one (CAS 73483-88-2) is a chemical compound with the molecular formula C20H28O2 and a molecular weight of 300.4 g/mol. IUPAC name: (1S,2S,5R,8S,11R,12R)-2,12-dimethyl-6-methylidene-16-oxapentacyclo[10.3.2.15,8.01,11.02,8]octadecan-17-one. InChIKey: ZPJLCCRNYWMMRT-GFBDQPOWSA-N.
| Molecular formula | C20H28O2 |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | (1S,2S,5R,8S,11R,12R)-2,12-dimethyl-6-methylidene-16-oxapentacyclo[10.3.2.15,8.01,11.02,8]octadecan-17-one |
| InChIKey | ZPJLCCRNYWMMRT-GFBDQPOWSA-N |
| SMILES | C[C@@]12CCC[C@@]3([C@@H]1CC[C@]45[C@@]3(CC[C@H](C4)C(=C)C5)C)OC2=O |
Computed by PubChem (NCBI)
Synonyms:
Tetrachyrin, orb1681583