Products 735336-37-5

CAS 735336-37-5 is the registry number for 2-Methyl-5-(phenoxymethyl)furan-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-methyl-5-(phenoxymethyl)furan-3-carboxylic acid (CAS 735336-37-5) is a chemical compound with the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. IUPAC name: 2-methyl-5-(phenoxymethyl)furan-3-carboxylic acid. InChIKey: CPRWVHUVIQFSCC-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12O4
Molecular weight232.23 g/mol
IUPAC name2-methyl-5-(phenoxymethyl)furan-3-carboxylic acid
InChIKeyCPRWVHUVIQFSCC-UHFFFAOYSA-N
SMILESCC1=C(C=C(O1)COC2=CC=CC=C2)C(=O)O

Computed by PubChem (NCBI)