CAS 73575-57-2 appears in our catalog under these names: 2,2',3,4,6'-Pentachlorobiphenyl, PCB No. 89, PCB No. 89 10 µg/mL in Isooctane, PCB 89, ROTI®Star, 5 mg, glass, PCB 89, Concentration: 100 µg/ml Solvent: Isooctane. Offered by: TRC, Dr. Ehrenstorfer, Biosynth, Roth, HPC Standards. Available pack sizes: 250mg, 5mg, 10ml, 10mg, 50mg, 25mg, 1x5ml.
1,2,3-trichloro-4-(2,6-dichlorophenyl)benzene (CAS 73575-57-2) is a chemical compound with the molecular formula C12H5Cl5 and a molecular weight of 326.4 g/mol. IUPAC name: 1,2,3-trichloro-4-(2,6-dichlorophenyl)benzene. InChIKey: GLOOIONSKMZYQZ-UHFFFAOYSA-N.
| Molecular formula | C12H5Cl5 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 1,2,3-trichloro-4-(2,6-dichlorophenyl)benzene |
| InChIKey | GLOOIONSKMZYQZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C2=C(C(=C(C=C2)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)