CAS 73637-00-0 appears in our catalog under these names: Tetrakis(prop-2-yn-1-yl)azanium bromide, 95%, Tetrakis(prop-2-yn-1-yl)azanium bromide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Tetrakis(prop-2-ynyl)azanium bromide (CAS 73637-00-0) is a chemical compound with the molecular formula C12H12BrN and a molecular weight of 250.13 g/mol. IUPAC name: tetrakis(prop-2-ynyl)azanium bromide. InChIKey: MBDXHRCESWVPHA-UHFFFAOYSA-M.
| Molecular formula | C12H12BrN |
|---|---|
| Molecular weight | 250.13 g/mol |
| IUPAC name | tetrakis(prop-2-ynyl)azanium bromide |
| InChIKey | MBDXHRCESWVPHA-UHFFFAOYSA-M |
| SMILES | C#CC[N+](CC#C)(CC#C)CC#C.[Br-] |
Computed by PubChem (NCBI)