CAS 738614-23-8 is the registry number for Phloroglucinol Impurity 67. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-hydroxyphenoxy)benzene-1,4-diol (CAS 738614-23-8) is a chemical compound with the molecular formula C12H10O4 and a molecular weight of 218.20 g/mol. IUPAC name: 2-(4-hydroxyphenoxy)benzene-1,4-diol. InChIKey: GPCZPCRKPAEJIJ-UHFFFAOYSA-N.
| Molecular formula | C12H10O4 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | 2-(4-hydroxyphenoxy)benzene-1,4-diol |
| InChIKey | GPCZPCRKPAEJIJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1O)OC2=C(C=CC(=C2)O)O |
Computed by PubChem (NCBI)