CAS 739365-24-3 is the registry number for 4-methoxy-1,3-benzothiazole-6-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methoxy-1,3-benzothiazole-6-carboxylic acid (CAS 739365-24-3) is a chemical compound with the molecular formula C9H7NO3S and a molecular weight of 209.22 g/mol. IUPAC name: 4-methoxy-1,3-benzothiazole-6-carboxylic acid. InChIKey: MOEPKJSMMGGFEQ-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3S |
|---|---|
| Molecular weight | 209.22 g/mol |
| IUPAC name | 4-methoxy-1,3-benzothiazole-6-carboxylic acid |
| InChIKey | MOEPKJSMMGGFEQ-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=CC(=C1)C(=O)O)SC=N2 |
Computed by PubChem (NCBI)