CAS 7394-78-7 appears in our catalog under these names: 3-(5-Fluoro-1H-indol-3-yl)propanoic acid, 96%, 3–(5–Fluoro–1H–indol–3–yl)propanoic acid, 5-Fluoro-1H-indole-3-propanoic acid, 95%, 95%, 3-(5-Fluoro-1H-indol-3-yl)propanoic acid, 95%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
3-(5-fluoro-1H-indol-3-yl)propanoic acid (CAS 7394-78-7) is a chemical compound with the molecular formula C11H10FNO2 and a molecular weight of 207.20 g/mol. IUPAC name: 3-(5-fluoro-1H-indol-3-yl)propanoic acid. InChIKey: VWGFABPQHOAUQY-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO2 |
|---|---|
| Molecular weight | 207.20 g/mol |
| IUPAC name | 3-(5-fluoro-1H-indol-3-yl)propanoic acid |
| InChIKey | VWGFABPQHOAUQY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=CN2)CCC(=O)O |
Computed by PubChem (NCBI)