Products 7396-28-3
CAS 7396-28-3 appears in our catalog under these names: 3-(3-chlorophenyl)prop-2-ynoic acid, 3-(3-Chlorophenyl)propiolic acid, 98%, 98%, 3-(3-Chlorophenyl)prop-2-ynoic acid, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 2,5g, 5g, 100mg, 250mg, 1g, 10g.
3-(3-chlorophenyl)prop-2-ynoic acid (CAS 7396-28-3) is a chemical compound with the molecular formula C9H5ClO2 and a molecular weight of 180.59 g/mol. IUPAC name: 3-(3-chlorophenyl)prop-2-ynoic acid. InChIKey: FRTZPNZKFMZQDR-UHFFFAOYSA-N.
| Molecular formula | C9H5ClO2 |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 3-(3-chlorophenyl)prop-2-ynoic acid |
| InChIKey | FRTZPNZKFMZQDR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C#CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(3-Chlorophenyl)propiolic acid, 2-Propynoic acid, 3-(3-chlorophenyl)-, Propiolic acid, (m-chlorophenyl)-, Propynoic acid, (3-chlorophenyl)-, Propiolic acid, (mchlorophenyl), Propynoic acid, (3chlorophenyl), 2Propynoic acid, 3(3chlorophenyl), Propiolic acid, (m-chlorophenyl)-(8CI), 2-Propynoic acid, 3-(3-chlorophenyl)-(9CI), 3-(3-chlorophenyl)prop-2-ynoic acid