CAS 747371-90-0 appears in our catalog under these names: (S)-4-Amino-3-(4-fluorophenyl)butanoic acid, 95%, (S)-4-Amino-3-(4-fluorophenyl)butanoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 500mg, 1000mg.
(3S)-4-amino-3-(4-fluorophenyl)butanoic acid (CAS 747371-90-0) is a chemical compound with the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. IUPAC name: (3S)-4-amino-3-(4-fluorophenyl)butanoic acid. InChIKey: QWHXHLDNSXLAPX-MRVPVSSYSA-N.
| Molecular formula | C10H12FNO2 |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | (3S)-4-amino-3-(4-fluorophenyl)butanoic acid |
| InChIKey | QWHXHLDNSXLAPX-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC=C1[C@H](CC(=O)O)CN)F |
Computed by PubChem (NCBI)