CAS 74152-17-3 is the registry number for 3-Chloro-2,5-diisopropylpyrazine, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 1g.
3-chloro-2,5-di(propan-2-yl)pyrazine (CAS 74152-17-3) is a chemical compound with the molecular formula C10H15ClN2 and a molecular weight of 198.69 g/mol. IUPAC name: 3-chloro-2,5-di(propan-2-yl)pyrazine. InChIKey: BBIWVGIJONRRJB-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2 |
|---|---|
| Molecular weight | 198.69 g/mol |
| IUPAC name | 3-chloro-2,5-di(propan-2-yl)pyrazine |
| InChIKey | BBIWVGIJONRRJB-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CN=C(C(=N1)Cl)C(C)C |
Computed by PubChem (NCBI)