CAS 74202-01-0 is the registry number for Z-D-Ala-Ala-OH, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[[(2R)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid (CAS 74202-01-0) is a chemical compound with the molecular formula C14H18N2O5 and a molecular weight of 294.30 g/mol. IUPAC name: (2S)-2-[[(2R)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid. InChIKey: JBGCVTHXXTVYIP-ZJUUUORDSA-N.
| Molecular formula | C14H18N2O5 |
|---|---|
| Molecular weight | 294.30 g/mol |
| IUPAC name | (2S)-2-[[(2R)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid |
| InChIKey | JBGCVTHXXTVYIP-ZJUUUORDSA-N |
| SMILES | C[C@H](C(=O)N[C@@H](C)C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)