Products 74202-01-0

CAS 74202-01-0 is the registry number for Z-D-Ala-Ala-OH, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2S)-2-[[(2R)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid (CAS 74202-01-0) is a chemical compound with the molecular formula C14H18N2O5 and a molecular weight of 294.30 g/mol. IUPAC name: (2S)-2-[[(2R)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid. InChIKey: JBGCVTHXXTVYIP-ZJUUUORDSA-N.

Identity
Molecular formulaC14H18N2O5
Molecular weight294.30 g/mol
IUPAC name(2S)-2-[[(2R)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid
InChIKeyJBGCVTHXXTVYIP-ZJUUUORDSA-N
SMILESC[C@H](C(=O)N[C@@H](C)C(=O)O)NC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)

Synonyms: Z-D-Ala-Ala-OH