Products 74228-83-4
CAS 74228-83-4 appears in our catalog under these names: DL-Phenyl-d5-alanine-3,3-d2, 98 atom % D, min 98% Chemical Purity, DL–PHENYL–D5–ALANINE–3，3–D2, DL-3-Phenylalanine-d7. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 10mg, 1mg, 5mg.
2-amino-3,3-dideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid (CAS 74228-83-4) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 172.23 g/mol. IUPAC name: 2-amino-3,3-dideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid. InChIKey: COLNVLDHVKWLRT-XZJKGWKKSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 172.23 g/mol |
| IUPAC name | 2-amino-3,3-dideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid |
| InChIKey | COLNVLDHVKWLRT-XZJKGWKKSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])C(C(=O)O)N)[2H])[2H] |
Computed by PubChem (NCBI)