Products 742691-70-9
CAS 742691-70-9 appears in our catalog under these names: (R)-3-Amino-3-(2,3-dimethoxy-phenyl)-propionic acid, 95%, (R)-3-Amino-3-(2,3-dimethoxyphenyl)propanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
(3R)-3-amino-3-(2,3-dimethoxyphenyl)propanoic acid (CAS 742691-70-9) is a chemical compound with the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. IUPAC name: (3R)-3-amino-3-(2,3-dimethoxyphenyl)propanoic acid. InChIKey: XZFWLSJPXJTSMZ-MRVPVSSYSA-N.
| Molecular formula | C11H15NO4 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | (3R)-3-amino-3-(2,3-dimethoxyphenyl)propanoic acid |
| InChIKey | XZFWLSJPXJTSMZ-MRVPVSSYSA-N |
| SMILES | COC1=CC=CC(=C1OC)[C@@H](CC(=O)O)N |
Computed by PubChem (NCBI)