Products 5448-16-8
CAS 5448-16-8 appears in our catalog under these names: 3-Methyl-1h-pyrrole 2,4-dicarboxylic acid diethyl ester, 95%, Diethyl 3-methyl-1H-pyrrole-2,4-dicarboxylate 97%, Diethyl 3-methyl-1H-pyrrole-2,4-dicarboxylate, 97%, 97%, Diethyl 3-methyl-1H-pyrrole-2,4-dicarboxylate, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg, 10g.
Diethyl 3-methyl-1H-pyrrole-2,4-dicarboxylate (CAS 5448-16-8) is a chemical compound with the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. IUPAC name: diethyl 3-methyl-1H-pyrrole-2,4-dicarboxylate. InChIKey: KJPYNVNXXUELAB-UHFFFAOYSA-N.
| Molecular formula | C11H15NO4 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | diethyl 3-methyl-1H-pyrrole-2,4-dicarboxylate |
| InChIKey | KJPYNVNXXUELAB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC(=C1C)C(=O)OCC |
Computed by PubChem (NCBI)
Synonyms:
diethyl 3-methyl-1h-pyrrole-2,4-dicarboxylate, 3-Methyl-1H-pyrrole 2,4-dicarboxylic acid diethyl ester, 2,4-diethyl 3-methyl-1H-pyrrole-2,4-dicarboxylate, 3-Methyl-1H-pyrrole-2,4-dicarboxylic acid diethyl ester, Diethyl 3-methylpyrrole-2,4-dicarboxylate, diethyl3-methyl-1H-pyrrole-2,4-dicarboxylate, 2,4-dicarbethoxy-3 methylpyrrole, KJPYNVNXXUELAB-UHFFFAOYSA-N, 2, 4-dicarbethoxy-3 methylpyrrole