CAS 796079-90-8 appears in our catalog under these names: 4-(Isopropoxycarbonyl)-3,5-dimethyl-1h-pyrrole-2-carboxylic acid, 95%, 4-(Isopropoxycarbonyl)-3,5-dimethyl-1H-pyrrole-2-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
3,5-dimethyl-4-propan-2-yloxycarbonyl-1H-pyrrole-2-carboxylic acid (CAS 796079-90-8) is a chemical compound with the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. IUPAC name: 3,5-dimethyl-4-propan-2-yloxycarbonyl-1H-pyrrole-2-carboxylic acid. InChIKey: BUDAPQLSIBPJFI-UHFFFAOYSA-N.
| Molecular formula | C11H15NO4 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | 3,5-dimethyl-4-propan-2-yloxycarbonyl-1H-pyrrole-2-carboxylic acid |
| InChIKey | BUDAPQLSIBPJFI-UHFFFAOYSA-N |
| SMILES | CC1=C(NC(=C1C(=O)OC(C)C)C)C(=O)O |
Computed by PubChem (NCBI)