CAS 362000-58-6 appears in our catalog under these names: 3-(1,3-Dioxooctahydro-2h-isoindol-2-yl)propanoic acid, 95%, 3-(1,3-Dioxohexahydro-1H-isoindol-2(3H)-yl)propanoic acid, 97%, 3-(1,3-Dioxo-octahydro-isoindol-2-yl)-propionic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoic acid (CAS 362000-58-6) is a chemical compound with the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. IUPAC name: 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoic acid. InChIKey: IJLCTNHKIXADOV-UHFFFAOYSA-N.
| Molecular formula | C11H15NO4 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoic acid |
| InChIKey | IJLCTNHKIXADOV-UHFFFAOYSA-N |
| SMILES | C1CCC2C(C1)C(=O)N(C2=O)CCC(=O)O |
Computed by PubChem (NCBI)