Products 54584-26-8

CAS 54584-26-8 is the registry number for 4-ethyl 2-methyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-O-ethyl 2-O-methyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate (CAS 54584-26-8) is a chemical compound with the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. IUPAC name: 4-O-ethyl 2-O-methyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate. InChIKey: QSQVYFAWEAJJDN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15NO4
Molecular weight225.24 g/mol
IUPAC name4-O-ethyl 2-O-methyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate
InChIKeyQSQVYFAWEAJJDN-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(NC(=C1C)C(=O)OC)C

Computed by PubChem (NCBI)