Products 74431-38-2
CAS 74431-38-2 is the registry number for (2S,3S)-2,3-Diphenylsuccinic Acid. Offered by: TRC. Available pack sizes: 2,5g.
(2S,3S)-2,3-diphenylbutanedioic acid (CAS 74431-38-2) is a chemical compound with the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. IUPAC name: (2S,3S)-2,3-diphenylbutanedioic acid. InChIKey: PVXCQHHWNDJIJP-ZIAGYGMSSA-N.
| Molecular formula | C16H14O4 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | (2S,3S)-2,3-diphenylbutanedioic acid |
| InChIKey | PVXCQHHWNDJIJP-ZIAGYGMSSA-N |
| SMILES | C1=CC=C(C=C1)[C@H]([C@@H](C2=CC=CC=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)