Products 74474-76-3
CAS 74474-76-3 is the registry number for Casegravol. Offered by: MedChemExpress. Available pack sizes: Get quote.
8-[(E)-3,4-dihydroxy-3-methylbut-1-enyl]-7-methoxychromen-2-one (CAS 74474-76-3) is a chemical compound with the molecular formula C15H16O5 and a molecular weight of 276.28 g/mol. IUPAC name: 8-[(E)-3,4-dihydroxy-3-methylbut-1-enyl]-7-methoxychromen-2-one. InChIKey: XVVRFNCLKCYMPH-BQYQJAHWSA-N.
| Molecular formula | C15H16O5 |
|---|---|
| Molecular weight | 276.28 g/mol |
| IUPAC name | 8-[(E)-3,4-dihydroxy-3-methylbut-1-enyl]-7-methoxychromen-2-one |
| InChIKey | XVVRFNCLKCYMPH-BQYQJAHWSA-N |
| SMILES | CC(CO)(/C=C/C1=C(C=CC2=C1OC(=O)C=C2)OC)O |
Computed by PubChem (NCBI)