CAS 74536-29-1 appears in our catalog under these names: (S)–2–Amino–3–((tert–butoxycarbonyl)amino)propanoic acid, H-L-Dap(Boc)-OH, N-b-Boc-L-2,3-diaminopropionic acid, H-Dap(Boc)-OH 98%, H-Dap(Boc)-OH, 98%, 98%. Offered by: GLPBio, Iris Biotech, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 25g, 5g, 2g, 10g, 100mg, 250mg, 100g.
(2S)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 74536-29-1) is a chemical compound with the molecular formula C8H16N2O4 and a molecular weight of 204.22 g/mol. IUPAC name: (2S)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: ZSJIIZWMJVWKIR-YFKPBYRVSA-N.
| Molecular formula | C8H16N2O4 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | (2S)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | ZSJIIZWMJVWKIR-YFKPBYRVSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)