CAS 7455-77-8 is the registry number for β-Glucuronidase-IN-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(4-chlorophenyl)-3H-quinazolin-4-one (CAS 7455-77-8) is a chemical compound with the molecular formula C14H9ClN2O and a molecular weight of 256.68 g/mol. IUPAC name: 2-(4-chlorophenyl)-3H-quinazolin-4-one. InChIKey: AKHUKZJZNGHOJU-UHFFFAOYSA-N.
| Molecular formula | C14H9ClN2O |
|---|---|
| Molecular weight | 256.68 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-3H-quinazolin-4-one |
| InChIKey | AKHUKZJZNGHOJU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC(=N2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)