Products 74560-05-7
CAS 74560-05-7 is the registry number for Isomedicarpin. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-methoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-9-ol (CAS 74560-05-7) is a chemical compound with the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. IUPAC name: 3-methoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-9-ol. InChIKey: YHZDBBUEVZEOIY-UHFFFAOYSA-N.
| Molecular formula | C16H14O4 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | 3-methoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-9-ol |
| InChIKey | YHZDBBUEVZEOIY-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C3C(CO2)C4=C(O3)C=C(C=C4)O |
Computed by PubChem (NCBI)