CAS 7463-53-8 appears in our catalog under these names: Indobufen Impurity 11, 2-(4-NITROPHENYL)BUTYRIC ACID 98%, 2-(4-Nitrophenyl)butanoic acid, 98%, 98%, 2-(4-Nitrophenyl)butanoic acid, 95%. Offered by: Chemat Brand, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 5g, 25g, 100g, 500g, 1kg, 1g.
2-(4-nitrophenyl)butanoic acid (CAS 7463-53-8) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: 2-(4-nitrophenyl)butanoic acid. InChIKey: XBGNOMBPRQVJSR-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | 2-(4-nitrophenyl)butanoic acid |
| InChIKey | XBGNOMBPRQVJSR-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC=C(C=C1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)