Products 746677-85-0
CAS 746677-85-0 is the registry number for (4R)-2-(Naphthalen-1-yl)-1,3-thiazolidine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
(4R)-2-naphthalen-1-yl-1,3-thiazolidine-4-carboxylic acid (CAS 746677-85-0) is a chemical compound with the molecular formula C14H13NO2S and a molecular weight of 259.33 g/mol. IUPAC name: (4R)-2-naphthalen-1-yl-1,3-thiazolidine-4-carboxylic acid. InChIKey: WSGHWUWDWJRTFR-UEWDXFNNSA-N.
| Molecular formula | C14H13NO2S |
|---|---|
| Molecular weight | 259.33 g/mol |
| IUPAC name | (4R)-2-naphthalen-1-yl-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | WSGHWUWDWJRTFR-UEWDXFNNSA-N |
| SMILES | C1[C@H](NC(S1)C2=CC=CC3=CC=CC=C32)C(=O)O |
Computed by PubChem (NCBI)