CAS 74764-52-6 is the registry number for 1,2–Di(pyridin–2–yl)benzene. Offered by: GLPBio. Available pack sizes: 1g.
2-(2-pyridin-2-ylphenyl)pyridine (CAS 74764-52-6) is a chemical compound with the molecular formula C16H12N2 and a molecular weight of 232.28 g/mol. IUPAC name: 2-(2-pyridin-2-ylphenyl)pyridine. InChIKey: RDRFGXIWFMNZRW-UHFFFAOYSA-N.
| Molecular formula | C16H12N2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | 2-(2-pyridin-2-ylphenyl)pyridine |
| InChIKey | RDRFGXIWFMNZRW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=CC=N2)C3=CC=CC=N3 |
Computed by PubChem (NCBI)